C22H30N6O5S — CID 110172010
6-(4-benzylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine (PubChem CID 110172010) has the molecular formula C22H30N6O5S and a molecular weight of 490.59 g/mol. Its IUPAC name is 6-(4-benzylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine.
| Compound Name | 6-(4-benzylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110172010 |
| Molecular Formula | C22H30N6O5S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 6-(4-benzylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)nc1NCCN1CCOCC1 |
| InChI | InChI=1S/C22H30N6O5S/c29-28(30)20-6-7-21(24-22(20)23-8-9-25-14-16-33-17-15-25)26-10-12-27(13-11-26)34(31,32)18-19-4-2-1-3-5-19/h1-7H,8-18H2,(H,23,24) |
| InChIKey | GGKRDYOEBNMDRB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|