C27H36N6O3S — CID 110184031
N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-[4-(3,4-dimethylphenyl)piperazin-1-yl]-3-nitropyridin-2-amine (PubChem CID 110184031) has the molecular formula C27H36N6O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-[4-(3,4-dimethylphenyl)piperazin-1-yl]-3-nitropyridin-2-amine.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-[4-(3,4-dimethylphenyl)piperazin-1-yl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110184031 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-6-[4-(3,4-dimethylphenyl)piperazin-1-yl]-3-nitropyridin-2-amine |
| SMILES | Cc1ccc(N2CCN(c3ccc([N+](=O)[O-])c(NCCSCc4ccc(CN(C)C)o4)n3)CC2)cc1C |
| InChI | InChI=1S/C27H36N6O3S/c1-20-5-6-22(17-21(20)2)31-12-14-32(15-13-31)26-10-9-25(33(34)35)27(29-26)28-11-16-37-19-24-8-7-23(36-24)18-30(3)4/h5-10,17H,11-16,18-19H2,1-4H3,(H,28,29) |
| InChIKey | VLZDBWZTZAIMCX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|