C19H22Cl3N3O5S2 — CID 19847900
phenyl N-methylsulfonyl-N'-[2-[[5-[[methyl-(2,2,2-trichloroacetyl)amino]methyl]furan-2-yl]methylsulfanyl]ethyl]carbamimidate (PubChem CID 19847900) has the molecular formula C19H22Cl3N3O5S2 and a molecular weight of 542.89 g/mol. Its IUPAC name is phenyl N-methylsulfonyl-N'-[2-[[5-[[methyl-(2,2,2-trichloroacetyl)amino]methyl]furan-2-yl]methylsulfanyl]ethyl]carbamimidate.
| Compound Name | phenyl N-methylsulfonyl-N'-[2-[[5-[[methyl-(2,2,2-trichloroacetyl)amino]methyl]furan-2-yl]methylsulfanyl]ethyl]carbamimidate |
|---|---|
| PubChem CID | 19847900 |
| Molecular Formula | C19H22Cl3N3O5S2 |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | phenyl N-methylsulfonyl-N'-[2-[[5-[[methyl-(2,2,2-trichloroacetyl)amino]methyl]furan-2-yl]methylsulfanyl]ethyl]carbamimidate |
| SMILES | CN(Cc1ccc(CSCC/N=C(\NS(C)(=O)=O)Oc2ccccc2)o1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H22Cl3N3O5S2/c1-25(17(26)19(20,21)22)12-15-8-9-16(29-15)13-31-11-10-23-18(24-32(2,27)28)30-14-6-4-3-5-7-14/h3-9H,10-13H2,1-2H3,(H,23,24) |
| InChIKey | KCLPCYKLAKEGKK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|