C9H18Cl2N2O2S — CID 131712297
N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-methylhydroxylamine;dihydrochloride (PubChem CID 131712297) has the molecular formula C9H18Cl2N2O2S and a molecular weight of 289.23 g/mol. Its IUPAC name is N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-methylhydroxylamine;dihydrochloride.
| Compound Name | N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-methylhydroxylamine;dihydrochloride |
|---|---|
| PubChem CID | 131712297 |
| Molecular Formula | C9H18Cl2N2O2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-methylhydroxylamine;dihydrochloride |
| SMILES | CN(O)Cc1ccc(CSCCN)o1.Cl.Cl |
| InChI | InChI=1S/C9H16N2O2S.2ClH/c1-11(12)6-8-2-3-9(13-8)7-14-5-4-10;;/h2-3,12H,4-7,10H2,1H3;2*1H |
| InChIKey | QEEOVKJIGHESIH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|