C10H18N2O2S — CID 54401873
N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-ethylhydroxylamine (PubChem CID 54401873) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-ethylhydroxylamine.
| Compound Name | N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-ethylhydroxylamine |
|---|---|
| PubChem CID | 54401873 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-[[5-(2-aminoethylsulfanylmethyl)furan-2-yl]methyl]-N-ethylhydroxylamine |
| SMILES | CCN(O)Cc1ccc(CSCCN)o1 |
| InChI | InChI=1S/C10H18N2O2S/c1-2-12(13)7-9-3-4-10(14-9)8-15-6-5-11/h3-4,13H,2,5-8,11H2,1H3 |
| InChIKey | VNZHIFZKNSLYME-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|