C10H12Cl3NO4 — CID 14671748
2,2,2-trichloroethyl N-[[5-(hydroxymethyl)furan-2-yl]methyl]-N-methylcarbamate (PubChem CID 14671748) has the molecular formula C10H12Cl3NO4 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[[5-(hydroxymethyl)furan-2-yl]methyl]-N-methylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-[[5-(hydroxymethyl)furan-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 14671748 |
| Molecular Formula | C10H12Cl3NO4 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-[[5-(hydroxymethyl)furan-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc(CO)o1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO4/c1-14(9(16)17-6-10(11,12)13)4-7-2-3-8(5-15)18-7/h2-3,15H,4-6H2,1H3 |
| InChIKey | UCDGJUFESFZUCR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|