C11H14Cl3NO3S — CID 91317945
2,2,2-trichloroethyl N-[(3S)-3-hydroxy-3-thiophen-2-ylpropyl]-N-methylcarbamate (PubChem CID 91317945) has the molecular formula C11H14Cl3NO3S and a molecular weight of 346.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(3S)-3-hydroxy-3-thiophen-2-ylpropyl]-N-methylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(3S)-3-hydroxy-3-thiophen-2-ylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91317945 |
| Molecular Formula | C11H14Cl3NO3S |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(3S)-3-hydroxy-3-thiophen-2-ylpropyl]-N-methylcarbamate |
| SMILES | CN(CC[C@H](O)c1cccs1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3NO3S/c1-15(10(17)18-7-11(12,13)14)5-4-8(16)9-3-2-6-19-9/h2-3,6,8,16H,4-5,7H2,1H3/t8-/m0/s1 |
| InChIKey | AECPEFOQTVFXKC-QMMMGPOBSA-N |
| XLogP | 3.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|