C14H26N4O3S2 — CID 20570913
2-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-methyl-1-methylsulfonylguanidine (PubChem CID 20570913) has the molecular formula C14H26N4O3S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-methyl-1-methylsulfonylguanidine.
| Compound Name | 2-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-methyl-1-methylsulfonylguanidine |
|---|---|
| PubChem CID | 20570913 |
| Molecular Formula | C14H26N4O3S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-methyl-1-methylsulfonylguanidine |
| SMILES | Cc1cc(CSCC/N=C(\N)N(C)S(C)(=O)=O)oc1CN(C)C |
| InChI | InChI=1S/C14H26N4O3S2/c1-11-8-12(21-13(11)9-17(2)3)10-22-7-6-16-14(15)18(4)23(5,19)20/h8H,6-7,9-10H2,1-5H3,(H2,15,16) |
| InChIKey | QAQQWWYGTQHJRY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|