C11H15N7O3S2 — CID 174347287
2-[4-[5-[2-amino-2-(methylamino)-2-(sulfonylamino)ethyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 174347287) has the molecular formula C11H15N7O3S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-[4-[5-[2-amino-2-(methylamino)-2-(sulfonylamino)ethyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[5-[2-amino-2-(methylamino)-2-(sulfonylamino)ethyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 174347287 |
| Molecular Formula | C11H15N7O3S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[4-[5-[2-amino-2-(methylamino)-2-(sulfonylamino)ethyl]furan-2-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CNC(N)(Cc1ccc(-c2csc(N=C(N)N)n2)o1)N=S(=O)=O |
| InChI | InChI=1S/C11H15N7O3S2/c1-15-11(14,18-23(19)20)4-6-2-3-8(21-6)7-5-22-10(16-7)17-9(12)13/h2-3,5,15H,4,14H2,1H3,(H4,12,13,16,17) |
| InChIKey | VHRUWEFHVSSSJS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|