C12H14N6OS — CID 19439678
[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methylurea (PubChem CID 19439678) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is [3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methylurea.
| Compound Name | [3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methylurea |
|---|---|
| PubChem CID | 19439678 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]methylurea |
| SMILES | NC(=O)NCc1cccc(-c2csc(N=C(N)N)n2)c1 |
| InChI | InChI=1S/C12H14N6OS/c13-10(14)18-12-17-9(6-20-12)8-3-1-2-7(4-8)5-16-11(15)19/h1-4,6H,5H2,(H3,15,16,19)(H4,13,14,17,18) |
| InChIKey | HBHLCCOONOCOOP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|