C11H10N6S — CID 20552227
2-[4-[3-(cyanoamino)phenyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 20552227) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[4-[3-(cyanoamino)phenyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[3-(cyanoamino)phenyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 20552227 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[4-[3-(cyanoamino)phenyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | N#CNc1cccc(-c2csc(N=C(N)N)n2)c1 |
| InChI | InChI=1S/C11H10N6S/c12-6-15-8-3-1-2-7(4-8)9-5-18-11(16-9)17-10(13)14/h1-5,15H,(H4,13,14,16,17) |
| InChIKey | KANQAODGAQMTII-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|