C15H18N8OS — CID 57169027
2-cyano-1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-1-(2-methoxyethyl)guanidine (PubChem CID 57169027) has the molecular formula C15H18N8OS and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-cyano-1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-1-(2-methoxyethyl)guanidine.
| Compound Name | 2-cyano-1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-1-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 57169027 |
| Molecular Formula | C15H18N8OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-cyano-1-[3-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]phenyl]-1-(2-methoxyethyl)guanidine |
| SMILES | COCCN(/C(N)=N/C#N)c1cccc(-c2csc(N=C(N)N)n2)c1 |
| InChI | InChI=1S/C15H18N8OS/c1-24-6-5-23(14(19)20-9-16)11-4-2-3-10(7-11)12-8-25-15(21-12)22-13(17)18/h2-4,7-8H,5-6H2,1H3,(H2,19,20)(H4,17,18,21,22) |
| InChIKey | PIXLAEGKPBTMCC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|