C14H23N5O2S — CID 70505503
1-N'-[3-[[6-[(dimethylamino)methyl]-2-pyridinyl]sulfanyl]propyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 70505503) has the molecular formula C14H23N5O2S and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-N'-[3-[[6-[(dimethylamino)methyl]-2-pyridinyl]sulfanyl]propyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-[3-[[6-[(dimethylamino)methyl]-2-pyridinyl]sulfanyl]propyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70505503 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-N'-[3-[[6-[(dimethylamino)methyl]-2-pyridinyl]sulfanyl]propyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CNC(=C[N+](=O)[O-])NCCCSc1cccc(CN(C)C)n1 |
| InChI | InChI=1S/C14H23N5O2S/c1-15-13(11-19(20)21)16-8-5-9-22-14-7-4-6-12(17-14)10-18(2)3/h4,6-7,11,15-16H,5,8-10H2,1-3H3 |
| InChIKey | RDWFJLWBZTUNFG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|