C15H24N4O3 — CID 67946533
(Z)-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 67946533) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (Z)-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-N-methyl-2-nitroethene-1,1-diamine.
| Compound Name | (Z)-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-N-methyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 67946533 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (Z)-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C/[N+](=O)[O-])NCCCOc1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C15H24N4O3/c1-16-15(12-19(20)21)17-8-5-9-22-14-7-4-6-13(10-14)11-18(2)3/h4,6-7,10,12,16-17H,5,8-9,11H2,1-3H3/b15-12- |
| InChIKey | IJWPLVPRFDHUGL-QINSGFPZSA-N |
| XLogP | 1.40 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|