C32H50N8O6 — CID 88749784
N',N'-bis[1-[3-[3-[(dimethylamino)methyl]phenoxy]propylamino]-2-nitroethenyl]butane-1,4-diamine (PubChem CID 88749784) has the molecular formula C32H50N8O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is N',N'-bis[1-[3-[3-[(dimethylamino)methyl]phenoxy]propylamino]-2-nitroethenyl]butane-1,4-diamine.
| Compound Name | N',N'-bis[1-[3-[3-[(dimethylamino)methyl]phenoxy]propylamino]-2-nitroethenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 88749784 |
| Molecular Formula | C32H50N8O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | N',N'-bis[1-[3-[3-[(dimethylamino)methyl]phenoxy]propylamino]-2-nitroethenyl]butane-1,4-diamine |
| SMILES | CN(C)Cc1cccc(OCCCNC(=C[N+](=O)[O-])N(CCCCN)C(=C[N+](=O)[O-])NCCCOc2cccc(CN(C)C)c2)c1 |
| InChI | InChI=1S/C32H50N8O6/c1-36(2)23-27-11-7-13-29(21-27)45-19-9-16-34-31(25-39(41)42)38(18-6-5-15-33)32(26-40(43)44)35-17-10-20-46-30-14-8-12-28(22-30)24-37(3)4/h7-8,11-14,21-22,25-26,34-35H,5-6,9-10,15-20,23-24,33H2,1-4H3 |
| InChIKey | SLOHALJLHUDWMZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|