C25H39N5O5 — CID 70575271
1-N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine (PubChem CID 70575271) has the molecular formula C25H39N5O5 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70575271 |
| Molecular Formula | C25H39N5O5 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 1-N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-1-N'-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethene-1,1-diamine |
| SMILES | CN(C)Cc1cccc(OCCCNC(=C[N+](=O)[O-])NCCCOCc2ccc(CN(C)C)o2)c1 |
| InChI | InChI=1S/C25H39N5O5/c1-28(2)17-21-8-5-9-22(16-21)34-15-7-13-27-25(19-30(31)32)26-12-6-14-33-20-24-11-10-23(35-24)18-29(3)4/h5,8-11,16,19,26-27H,6-7,12-15,17-18,20H2,1-4H3 |
| InChIKey | QVKLUOOEZJCHEE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|