C30H43N5O4 — CID 20559430
2-nitro-1-N,1-N'-bis[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine (PubChem CID 20559430) has the molecular formula C30H43N5O4 and a molecular weight of 537.71 g/mol. Its IUPAC name is 2-nitro-1-N,1-N'-bis[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine.
| Compound Name | 2-nitro-1-N,1-N'-bis[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 20559430 |
| Molecular Formula | C30H43N5O4 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 2-nitro-1-N,1-N'-bis[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethene-1,1-diamine |
| SMILES | O=[N+]([O-])C=C(NCCCOc1cccc(CN2CCCC2)c1)NCCCOc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C30H43N5O4/c36-35(37)25-30(31-13-7-19-38-28-11-5-9-26(21-28)23-33-15-1-2-16-33)32-14-8-20-39-29-12-6-10-27(22-29)24-34-17-3-4-18-34/h5-6,9-12,21-22,25,31-32H,1-4,7-8,13-20,23-24H2 |
| InChIKey | QLJHFQUMFMRNQB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|