C25H35N5O4 — CID 67897333
1-(4-aminophenyl)-2-[[(E)-2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol (PubChem CID 67897333) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-[[(E)-2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol.
| Compound Name | 1-(4-aminophenyl)-2-[[(E)-2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol |
|---|---|
| PubChem CID | 67897333 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 1-(4-aminophenyl)-2-[[(E)-2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol |
| SMILES | Nc1ccc(C(O)CN/C(=C/[N+](=O)[O-])NCCCOc2cccc(CN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H35N5O4/c26-22-10-8-21(9-11-22)24(31)17-28-25(19-30(32)33)27-12-5-15-34-23-7-4-6-20(16-23)18-29-13-2-1-3-14-29/h4,6-11,16,19,24,27-28,31H,1-3,5,12-15,17-18,26H2/b25-19+ |
| InChIKey | PWFOIMVILLTFAW-NCELDCMTSA-N |
| XLogP | 3.01 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|