C25H33FN4O4 — CID 54380538
N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-nitro-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanimidamide (PubChem CID 54380538) has the molecular formula C25H33FN4O4 and a molecular weight of 472.56 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-nitro-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanimidamide.
| Compound Name | N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-nitro-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanimidamide |
|---|---|
| PubChem CID | 54380538 |
| Molecular Formula | C25H33FN4O4 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N'-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-nitro-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanimidamide |
| SMILES | O=[N+]([O-])C/C(=N\CC(O)c1ccc(F)cc1)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C25H33FN4O4/c26-22-10-8-21(9-11-22)24(31)17-28-25(19-30(32)33)27-12-5-15-34-23-7-4-6-20(16-23)18-29-13-2-1-3-14-29/h4,6-11,16,24,31H,1-3,5,12-15,17-19H2,(H,27,28) |
| InChIKey | UZONPCFDYRFTHG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|