C20H29N3O7S — CID 70547227
N-(1-methylsulfanyl-2-nitroethenyl)-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-1-amine;oxalic acid (PubChem CID 70547227) has the molecular formula C20H29N3O7S and a molecular weight of 455.53 g/mol. Its IUPAC name is N-(1-methylsulfanyl-2-nitroethenyl)-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-1-amine;oxalic acid.
| Compound Name | N-(1-methylsulfanyl-2-nitroethenyl)-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 70547227 |
| Molecular Formula | C20H29N3O7S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-(1-methylsulfanyl-2-nitroethenyl)-3-[3-(piperidin-1-ylmethyl)phenoxy]propan-1-amine;oxalic acid |
| SMILES | CSC(=C[N+](=O)[O-])NCCCOc1cccc(CN2CCCCC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H27N3O3S.C2H2O4/c1-25-18(15-21(22)23)19-9-6-12-24-17-8-5-7-16(13-17)14-20-10-3-2-4-11-20;3-1(4)2(5)6/h5,7-8,13,15,19H,2-4,6,9-12,14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HKPWEARLDFTNAL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|