C24H34N4O4S — CID 70356967
1-(4-methylthiophen-2-yl)-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol (PubChem CID 70356967) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is 1-(4-methylthiophen-2-yl)-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol.
| Compound Name | 1-(4-methylthiophen-2-yl)-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol |
|---|---|
| PubChem CID | 70356967 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-(4-methylthiophen-2-yl)-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethanol |
| SMILES | Cc1csc(C(O)CNC(=C[N+](=O)[O-])NCCCOc2cccc(CN3CCCCC3)c2)c1 |
| InChI | InChI=1S/C24H34N4O4S/c1-19-13-23(33-18-19)22(29)15-26-24(17-28(30)31)25-9-6-12-32-21-8-5-7-20(14-21)16-27-10-3-2-4-11-27/h5,7-8,13-14,17-18,22,25-26,29H,2-4,6,9-12,15-16H2,1H3 |
| InChIKey | VBPYJQIUGGHBRY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|