C25H34N4O5 — CID 70357009
3-[1-hydroxy-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethyl]phenol (PubChem CID 70357009) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[1-hydroxy-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethyl]phenol.
| Compound Name | 3-[1-hydroxy-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 70357009 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-[1-hydroxy-2-[[2-nitro-1-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]ethenyl]amino]ethyl]phenol |
| SMILES | O=[N+]([O-])C=C(NCCCOc1cccc(CN2CCCCC2)c1)NCC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C25H34N4O5/c30-22-9-5-8-21(16-22)24(31)17-27-25(19-29(32)33)26-11-6-14-34-23-10-4-7-20(15-23)18-28-12-2-1-3-13-28/h4-5,7-10,15-16,19,24,26-27,30-31H,1-3,6,11-14,17-18H2 |
| InChIKey | DXWWTONDQQEJTG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|