C26H36N2O3 — CID 15029681
5-(4-hydroxyphenyl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pentanamide (PubChem CID 15029681) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pentanamide.
| Compound Name | 5-(4-hydroxyphenyl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 15029681 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 5-(4-hydroxyphenyl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]pentanamide |
| SMILES | O=C(CCCCc1ccc(O)cc1)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C26H36N2O3/c29-24-14-12-22(13-15-24)8-2-3-11-26(30)27-16-7-19-31-25-10-6-9-23(20-25)21-28-17-4-1-5-18-28/h6,9-10,12-15,20,29H,1-5,7-8,11,16-19,21H2,(H,27,30) |
| InChIKey | HELGWDUGNSYRTD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|