C29H40N6O2 — CID 15179529
N-[2-[[N-cyano-N'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]carbamimidoyl]amino]ethyl]-4-phenylbutanamide (PubChem CID 15179529) has the molecular formula C29H40N6O2 and a molecular weight of 504.68 g/mol. Its IUPAC name is N-[2-[[N-cyano-N'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]carbamimidoyl]amino]ethyl]-4-phenylbutanamide.
| Compound Name | N-[2-[[N-cyano-N'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]carbamimidoyl]amino]ethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 15179529 |
| Molecular Formula | C29H40N6O2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | N-[2-[[N-cyano-N'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]carbamimidoyl]amino]ethyl]-4-phenylbutanamide |
| SMILES | N#CN/C(=N\CCCOc1cccc(CN2CCCCC2)c1)NCCNC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C29H40N6O2/c30-24-34-29(33-18-17-31-28(36)15-8-12-25-10-3-1-4-11-25)32-16-9-21-37-27-14-7-13-26(22-27)23-35-19-5-2-6-20-35/h1,3-4,7,10-11,13-14,22H,2,5-6,8-9,12,15-21,23H2,(H,31,36)(H2,32,33,34) |
| InChIKey | SGJWVPNPXHYIGM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|