C26H35N7O4 — CID 15179503
1-cyano-2-[2-hydroxy-3-(2-nitroanilino)propyl]-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine (PubChem CID 15179503) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 1-cyano-2-[2-hydroxy-3-(2-nitroanilino)propyl]-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine.
| Compound Name | 1-cyano-2-[2-hydroxy-3-(2-nitroanilino)propyl]-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine |
|---|---|
| PubChem CID | 15179503 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 1-cyano-2-[2-hydroxy-3-(2-nitroanilino)propyl]-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine |
| SMILES | N#CN/C(=N\CC(O)CNc1ccccc1[N+](=O)[O-])NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C26H35N7O4/c27-20-31-26(30-18-22(34)17-29-24-10-2-3-11-25(24)33(35)36)28-12-7-15-37-23-9-6-8-21(16-23)19-32-13-4-1-5-14-32/h2-3,6,8-11,16,22,29,34H,1,4-5,7,12-15,17-19H2,(H2,28,30,31) |
| InChIKey | FRNPSMZGALUWGF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|