C19H30N6O — CID 15179485
1-(2-aminoethyl)-3-cyano-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine (PubChem CID 15179485) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-cyano-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine.
| Compound Name | 1-(2-aminoethyl)-3-cyano-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine |
|---|---|
| PubChem CID | 15179485 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-(2-aminoethyl)-3-cyano-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]guanidine |
| SMILES | N#CN/C(=N\CCCOc1cccc(CN2CCCCC2)c1)NCCN |
| InChI | InChI=1S/C19H30N6O/c20-8-10-23-19(24-16-21)22-9-5-13-26-18-7-4-6-17(14-18)15-25-11-2-1-3-12-25/h4,6-7,14H,1-3,5,8-13,15,20H2,(H2,22,23,24) |
| InChIKey | HDNYARDFRMPQKD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|