C33H47N7O4 — CID 15179531
tert-butyl N-[4-[2-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethylamino]-2-oxoethyl]phenyl]carbamate (PubChem CID 15179531) has the molecular formula C33H47N7O4 and a molecular weight of 605.78 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethylamino]-2-oxoethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethylamino]-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 15179531 |
| Molecular Formula | C33H47N7O4 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.37 |
| IUPAC Name | tert-butyl N-[4-[2-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethylamino]-2-oxoethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(=O)NCCN/C(=N/CCCCOc2cccc(CN3CCCCC3)c2)NC#N)cc1 |
| InChI | InChI=1S/C33H47N7O4/c1-33(2,3)44-32(42)39-28-14-12-26(13-15-28)23-30(41)35-17-18-37-31(38-25-34)36-16-5-8-21-43-29-11-9-10-27(22-29)24-40-19-6-4-7-20-40/h9-15,22H,4-8,16-21,23-24H2,1-3H3,(H,35,41)(H,39,42)(H2,36,37,38) |
| InChIKey | WRLNFIHWLHBNHH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|