C27H36IN7O2 — CID 15179518
4-amino-N-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethyl]-3-iodobenzamide (PubChem CID 15179518) has the molecular formula C27H36IN7O2 and a molecular weight of 617.54 g/mol. Its IUPAC name is 4-amino-N-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethyl]-3-iodobenzamide.
| Compound Name | 4-amino-N-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 15179518 |
| Molecular Formula | C27H36IN7O2 |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 4-amino-N-[2-[[N-cyano-N'-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]carbamimidoyl]amino]ethyl]-3-iodobenzamide |
| SMILES | N#CN/C(=N\CCCCOc1cccc(CN2CCCCC2)c1)NCCNC(=O)c1ccc(N)c(I)c1 |
| InChI | InChI=1S/C27H36IN7O2/c28-24-18-22(9-10-25(24)30)26(36)31-12-13-33-27(34-20-29)32-11-2-5-16-37-23-8-6-7-21(17-23)19-35-14-3-1-4-15-35/h6-10,17-18H,1-5,11-16,19,30H2,(H,31,36)(H2,32,33,34) |
| InChIKey | LAUIVELZCGBQPT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|