C27H33N3O3 — CID 139680048
3-(2-oxo-1H-quinolin-4-yl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]propanamide (PubChem CID 139680048) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-(2-oxo-1H-quinolin-4-yl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]propanamide.
| Compound Name | 3-(2-oxo-1H-quinolin-4-yl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]propanamide |
|---|---|
| PubChem CID | 139680048 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-(2-oxo-1H-quinolin-4-yl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]propanamide |
| SMILES | O=C(CCc1cc(=O)[nH]c2ccccc12)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C27H33N3O3/c31-26(13-12-22-19-27(32)29-25-11-3-2-10-24(22)25)28-14-7-17-33-23-9-6-8-21(18-23)20-30-15-4-1-5-16-30/h2-3,6,8-11,18-19H,1,4-5,7,12-17,20H2,(H,28,31)(H,29,32) |
| InChIKey | SHGVPYFLUGPTOG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|