C25H34N2O3 — CID 58756726
2-[(4-methylphenyl)methoxy]-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide (PubChem CID 58756726) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methoxy]-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide.
| Compound Name | 2-[(4-methylphenyl)methoxy]-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 58756726 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 2-[(4-methylphenyl)methoxy]-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]acetamide |
| SMILES | Cc1ccc(COCC(=O)NCCCOc2cccc(CN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H34N2O3/c1-21-9-11-22(12-10-21)19-29-20-25(28)26-13-6-16-30-24-8-5-7-23(17-24)18-27-14-3-2-4-15-27/h5,7-12,17H,2-4,6,13-16,18-20H2,1H3,(H,26,28) |
| InChIKey | NSPDVARXQCRGLR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|