C15H23N3O3S — CID 54050323
methyl N-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethanimidothioate (PubChem CID 54050323) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is methyl N-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethanimidothioate.
| Compound Name | methyl N-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethanimidothioate |
|---|---|
| PubChem CID | 54050323 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl N-[3-[3-[(dimethylamino)methyl]phenoxy]propyl]-2-nitroethanimidothioate |
| SMILES | CS/C(C[N+](=O)[O-])=N\CCCOc1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C15H23N3O3S/c1-17(2)11-13-6-4-7-14(10-13)21-9-5-8-16-15(22-3)12-18(19)20/h4,6-7,10H,5,8-9,11-12H2,1-3H3/b16-15- |
| InChIKey | LSKWXYJCVSEXGJ-NXVVXOECSA-N |
| XLogP | 2.56 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|