C14H23NO — CID 142090571
N,N-dimethyl-1-[3-(3-methylbutoxy)phenyl]methanamine (PubChem CID 142090571) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(3-methylbutoxy)phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[3-(3-methylbutoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 142090571 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N,N-dimethyl-1-[3-(3-methylbutoxy)phenyl]methanamine |
| SMILES | CC(C)CCOc1cccc(CN(C)C)c1 |
| InChI | InChI=1S/C14H23NO/c1-12(2)8-9-16-14-7-5-6-13(10-14)11-15(3)4/h5-7,10,12H,8-9,11H2,1-4H3 |
| InChIKey | XMLAKKXHVSMGPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |