C21H29NO — CID 54796633
2,4,6-trimethyl-N-[[3-(3-methylbutoxy)phenyl]methyl]aniline (PubChem CID 54796633) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[[3-(3-methylbutoxy)phenyl]methyl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[[3-(3-methylbutoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 54796633 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2,4,6-trimethyl-N-[[3-(3-methylbutoxy)phenyl]methyl]aniline |
| SMILES | Cc1cc(C)c(NCc2cccc(OCCC(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C21H29NO/c1-15(2)9-10-23-20-8-6-7-19(13-20)14-22-21-17(4)11-16(3)12-18(21)5/h6-8,11-13,15,22H,9-10,14H2,1-5H3 |
| InChIKey | CWBSBVSMPQBPSG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |