C21H27NO — CID 39446655
N-[(3-cyclopentyloxyphenyl)methyl]-2,4,6-trimethylaniline (PubChem CID 39446655) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[(3-cyclopentyloxyphenyl)methyl]-2,4,6-trimethylaniline.
| Compound Name | N-[(3-cyclopentyloxyphenyl)methyl]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 39446655 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[(3-cyclopentyloxyphenyl)methyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NCc2cccc(OC3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C21H27NO/c1-15-11-16(2)21(17(3)12-15)22-14-18-7-6-10-20(13-18)23-19-8-4-5-9-19/h6-7,10-13,19,22H,4-5,8-9,14H2,1-3H3 |
| InChIKey | RLAHPEYMDBJBJV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |