C24H27NO — CID 54796665
2,4,6-trimethyl-N-[[3-(2-phenylethoxy)phenyl]methyl]aniline (PubChem CID 54796665) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[[3-(2-phenylethoxy)phenyl]methyl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[[3-(2-phenylethoxy)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 54796665 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2,4,6-trimethyl-N-[[3-(2-phenylethoxy)phenyl]methyl]aniline |
| SMILES | Cc1cc(C)c(NCc2cccc(OCCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C24H27NO/c1-18-14-19(2)24(20(3)15-18)25-17-22-10-7-11-23(16-22)26-13-12-21-8-5-4-6-9-21/h4-11,14-16,25H,12-13,17H2,1-3H3 |
| InChIKey | AACREALBHWOFMP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |