C16H26N4O3 — CID 57136214
N'-[3-[3-[2-(dimethylamino)ethyl]phenoxy]propyl]-2-nitropropanimidamide (PubChem CID 57136214) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-[3-[3-[2-(dimethylamino)ethyl]phenoxy]propyl]-2-nitropropanimidamide.
| Compound Name | N'-[3-[3-[2-(dimethylamino)ethyl]phenoxy]propyl]-2-nitropropanimidamide |
|---|---|
| PubChem CID | 57136214 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N'-[3-[3-[2-(dimethylamino)ethyl]phenoxy]propyl]-2-nitropropanimidamide |
| SMILES | CC(/C(N)=N/CCCOc1cccc(CCN(C)C)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C16H26N4O3/c1-13(20(21)22)16(17)18-9-5-11-23-15-7-4-6-14(12-15)8-10-19(2)3/h4,6-7,12-13H,5,8-11H2,1-3H3,(H2,17,18) |
| InChIKey | RNRORHGFNVVLHV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|