C14H24N4O4 — CID 54395993
N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-N'-methyl-2-nitroethanimidamide (PubChem CID 54395993) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-N'-methyl-2-nitroethanimidamide.
| Compound Name | N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-N'-methyl-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54395993 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[3-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]propyl]-N'-methyl-2-nitroethanimidamide |
| SMILES | C/N=C(\C[N+](=O)[O-])NCCCOCc1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C14H24N4O4/c1-15-14(10-18(19)20)16-7-4-8-21-11-13-6-5-12(22-13)9-17(2)3/h5-6H,4,7-11H2,1-3H3,(H,15,16) |
| InChIKey | VJZITSSUOVPKEC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|