C13H23N5O2S2 — CID 54284358
N-[2-[[2-[(dimethylamino)methyl]-5-methyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide (PubChem CID 54284358) has the molecular formula C13H23N5O2S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[2-[[2-[(dimethylamino)methyl]-5-methyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide.
| Compound Name | N-[2-[[2-[(dimethylamino)methyl]-5-methyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54284358 |
| Molecular Formula | C13H23N5O2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-[2-[[2-[(dimethylamino)methyl]-5-methyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-N'-methyl-2-nitroethanimidamide |
| SMILES | C/N=C(\C[N+](=O)[O-])NCCSCc1nc(CN(C)C)sc1C |
| InChI | InChI=1S/C13H23N5O2S2/c1-10-11(16-13(22-10)8-17(3)4)9-21-6-5-15-12(14-2)7-18(19)20/h5-9H2,1-4H3,(H,14,15) |
| InChIKey | RTBBLHNVNFXAGB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|