C22H32N4O5S — CID 54464719
N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N'-[[4-(2-methoxyethoxy)phenyl]methyl]-2-nitroethanimidamide (PubChem CID 54464719) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N'-[[4-(2-methoxyethoxy)phenyl]methyl]-2-nitroethanimidamide.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N'-[[4-(2-methoxyethoxy)phenyl]methyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54464719 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-N'-[[4-(2-methoxyethoxy)phenyl]methyl]-2-nitroethanimidamide |
| SMILES | COCCOc1ccc(C/N=C(\C[N+](=O)[O-])NCCSCc2ccc(CN(C)C)o2)cc1 |
| InChI | InChI=1S/C22H32N4O5S/c1-25(2)15-20-8-9-21(31-20)17-32-13-10-23-22(16-26(27)28)24-14-18-4-6-19(7-5-18)30-12-11-29-3/h4-9H,10-17H2,1-3H3,(H,23,24) |
| InChIKey | XEAOLMSFALQDKH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|