C14H19N5OS — CID 19439669
1-[4-[3-(aminomethyl)phenyl]-1,3-thiazol-2-yl]-2-(2-methoxyethyl)guanidine (PubChem CID 19439669) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 1-[4-[3-(aminomethyl)phenyl]-1,3-thiazol-2-yl]-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-[4-[3-(aminomethyl)phenyl]-1,3-thiazol-2-yl]-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 19439669 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[4-[3-(aminomethyl)phenyl]-1,3-thiazol-2-yl]-2-(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(\N)Nc1nc(-c2cccc(CN)c2)cs1 |
| InChI | InChI=1S/C14H19N5OS/c1-20-6-5-17-13(16)19-14-18-12(9-21-14)11-4-2-3-10(7-11)8-15/h2-4,7,9H,5-6,8,15H2,1H3,(H3,16,17,18,19) |
| InChIKey | HIYKNABHZWKGPW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|