C11H22N8O2S — CID 21298756
1-[5-(4,6-diamino-1,3,5-triazin-2-yl)pentyl]-2-methyl-3-methylsulfonylguanidine (PubChem CID 21298756) has the molecular formula C11H22N8O2S and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[5-(4,6-diamino-1,3,5-triazin-2-yl)pentyl]-2-methyl-3-methylsulfonylguanidine.
| Compound Name | 1-[5-(4,6-diamino-1,3,5-triazin-2-yl)pentyl]-2-methyl-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 21298756 |
| Molecular Formula | C11H22N8O2S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[5-(4,6-diamino-1,3,5-triazin-2-yl)pentyl]-2-methyl-3-methylsulfonylguanidine |
| SMILES | C/N=C(/NCCCCCc1nc(N)nc(N)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C11H22N8O2S/c1-14-11(19-22(2,20)21)15-7-5-3-4-6-8-16-9(12)18-10(13)17-8/h3-7H2,1-2H3,(H2,14,15,19)(H4,12,13,16,17,18) |
| InChIKey | HJQITKCRYDKDRH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 161.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|