C18H24F3N9O4 — CID 173403368
but-2-enedioic acid;1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine (PubChem CID 173403368) has the molecular formula C18H24F3N9O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is but-2-enedioic acid;1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine.
| Compound Name | but-2-enedioic acid;1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine |
|---|---|
| PubChem CID | 173403368 |
| Molecular Formula | C18H24F3N9O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | but-2-enedioic acid;1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCCc1nccc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H20F3N9.C4H4O4/c1-20-13(24-9-18)22-6-3-2-4-10-21-7-5-11(25-10)26-12(19)23-8-14(15,16)17;5-3(6)1-2-4(7)8/h5,7H,2-4,6,8H2,1H3,(H2,20,22,24)(H3,19,21,23,25,26);1-2H,(H,5,6)(H,7,8) |
| InChIKey | DHPPKENZGJUEFE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 211.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|