C20H25F3N6O4S — CID 70393668
but-2-enedioic acid;1-[6-[4-(1-methylimidazol-2-yl)butylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70393668) has the molecular formula C20H25F3N6O4S and a molecular weight of 502.52 g/mol. Its IUPAC name is but-2-enedioic acid;1-[6-[4-(1-methylimidazol-2-yl)butylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | but-2-enedioic acid;1-[6-[4-(1-methylimidazol-2-yl)butylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70393668 |
| Molecular Formula | C20H25F3N6O4S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | but-2-enedioic acid;1-[6-[4-(1-methylimidazol-2-yl)butylsulfanyl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | Cn1ccnc1CCCCSc1cccc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H21F3N6S.C4H4O4/c1-25-9-8-21-13(25)6-2-3-10-26-14-7-4-5-12(23-14)24-15(20)22-11-16(17,18)19;5-3(6)1-2-4(7)8/h4-5,7-9H,2-3,6,10-11H2,1H3,(H3,20,22,23,24);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KVFKJKSIRIUUMM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|