C15H20F3N7O5S — CID 70443467
(Z)-but-2-enedioic acid;5-[[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3,5-triazin-2-yl]sulfanyl]pentanamide (PubChem CID 70443467) has the molecular formula C15H20F3N7O5S and a molecular weight of 467.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;5-[[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3,5-triazin-2-yl]sulfanyl]pentanamide.
| Compound Name | (Z)-but-2-enedioic acid;5-[[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3,5-triazin-2-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 70443467 |
| Molecular Formula | C15H20F3N7O5S |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;5-[[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3,5-triazin-2-yl]sulfanyl]pentanamide |
| SMILES | NC(=O)CCCCSc1ncnc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H16F3N7OS.C4H4O4/c12-11(13,14)5-17-8(16)20-9-18-6-19-10(21-9)23-4-2-1-3-7(15)22;5-3(6)1-2-4(7)8/h6H,1-5H2,(H2,15,22)(H3,16,17,18,19,20,21);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KCZYJQOMQXLVRI-BTJKTKAUSA-N |
| XLogP | 0.62 |
| TPSA | 206.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|