C15H20F3N5O6 — CID 70482276
but-2-enedioic acid;1-[2-(4-hydroxybutoxy)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 70482276) has the molecular formula C15H20F3N5O6 and a molecular weight of 423.35 g/mol. Its IUPAC name is but-2-enedioic acid;1-[2-(4-hydroxybutoxy)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | but-2-enedioic acid;1-[2-(4-hydroxybutoxy)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 70482276 |
| Molecular Formula | C15H20F3N5O6 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | but-2-enedioic acid;1-[2-(4-hydroxybutoxy)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(OCCCCO)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H16F3N5O2.C4H4O4/c12-11(13,14)7-17-9(15)18-8-3-4-16-10(19-8)21-6-2-1-5-20;5-3(6)1-2-4(7)8/h3-4,20H,1-2,5-7H2,(H3,15,16,17,18,19);1-2H,(H,5,6)(H,7,8) |
| InChIKey | HLVIZSDYGYOWBG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|