C12H16F3N9O2S — CID 173406433
1-[2-[3-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 173406433) has the molecular formula C12H16F3N9O2S and a molecular weight of 407.38 g/mol. Its IUPAC name is 1-[2-[3-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[3-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 173406433 |
| Molecular Formula | C12H16F3N9O2S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[2-[3-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]propoxy]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(OCCC/N=c2\[nH][s+]([O-])nc2N)n1 |
| InChI | InChI=1S/C12H16F3N9O2S/c13-12(14,15)6-20-10(17)21-7-2-4-19-11(22-7)26-5-1-3-18-9-8(16)23-27(25)24-9/h2,4H,1,3,5-6H2,(H2,16,23)(H,18,24)(H3,17,19,20,21,22) |
| InChIKey | YWBUKPPHANMQJM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|