C14H19F6N7S — CID 21298875
1-(2,2,2-trifluoroethyl)-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]thiourea (PubChem CID 21298875) has the molecular formula C14H19F6N7S and a molecular weight of 431.41 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]thiourea.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]thiourea |
|---|---|
| PubChem CID | 21298875 |
| Molecular Formula | C14H19F6N7S |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butyl]thiourea |
| SMILES | N/C(=N\CC(F)(F)F)Nc1ccnc(CCCCNC(=S)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H19F6N7S/c15-13(16,17)7-24-11(21)27-10-4-6-22-9(26-10)3-1-2-5-23-12(28)25-8-14(18,19)20/h4,6H,1-3,5,7-8H2,(H2,23,25,28)(H3,21,22,24,26,27) |
| InChIKey | LWJZWIPJBQPMSV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|