C15H18F3N9S — CID 21298803
1-[2-[2-[[2,2-dicyano-1-(methylamino)ethenyl]amino]ethylsulfanylmethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 21298803) has the molecular formula C15H18F3N9S and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[2-[2-[[2,2-dicyano-1-(methylamino)ethenyl]amino]ethylsulfanylmethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[2-[2-[[2,2-dicyano-1-(methylamino)ethenyl]amino]ethylsulfanylmethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 21298803 |
| Molecular Formula | C15H18F3N9S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-[2-[2-[[2,2-dicyano-1-(methylamino)ethenyl]amino]ethylsulfanylmethyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CNC(NCCSCc1nccc(N/C(N)=N/CC(F)(F)F)n1)=C(C#N)C#N |
| InChI | InChI=1S/C15H18F3N9S/c1-22-13(10(6-19)7-20)24-4-5-28-8-12-23-3-2-11(26-12)27-14(21)25-9-15(16,17)18/h2-3,22,24H,4-5,8-9H2,1H3,(H3,21,23,25,26,27) |
| InChIKey | IKXGOTXBWDFMLT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|