C14H20F3N9S — CID 21298699
1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]guanidine (PubChem CID 21298699) has the molecular formula C14H20F3N9S and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]guanidine |
|---|---|
| PubChem CID | 21298699 |
| Molecular Formula | C14H20F3N9S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-cyano-2-methyl-3-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCCSc1nccc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N9S/c1-20-12(24-9-18)21-5-2-3-7-27-13-22-6-4-10(26-13)25-11(19)23-8-14(15,16)17/h4,6H,2-3,5,7-8H2,1H3,(H2,20,21,24)(H3,19,22,23,25,26) |
| InChIKey | OGOYHJIWZIXJOG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|