C18H24F3N7O6S — CID 173403205
but-2-enedioic acid;methyl N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butylcarbamothioyl]carbamate (PubChem CID 173403205) has the molecular formula C18H24F3N7O6S and a molecular weight of 523.49 g/mol. Its IUPAC name is but-2-enedioic acid;methyl N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butylcarbamothioyl]carbamate.
| Compound Name | but-2-enedioic acid;methyl N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butylcarbamothioyl]carbamate |
|---|---|
| PubChem CID | 173403205 |
| Molecular Formula | C18H24F3N7O6S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | but-2-enedioic acid;methyl N-[4-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]butylcarbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)NCCCCc1nccc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H20F3N7O2S.C4H4O4/c1-26-13(25)24-12(27)20-6-3-2-4-9-19-7-5-10(22-9)23-11(18)21-8-14(15,16)17;5-3(6)1-2-4(7)8/h5,7H,2-4,6,8H2,1H3,(H2,20,24,25,27)(H3,18,19,21,22,23);1-2H,(H,5,6)(H,7,8) |
| InChIKey | OGXSMVGFLRTBEG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 201.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|